C14H15N3O6 — CID 71388940
diethyl 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)propanedioate (PubChem CID 71388940) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is diethyl 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)propanedioate.
| Compound Name | diethyl 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)propanedioate |
|---|---|
| PubChem CID | 71388940 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | diethyl 2-(3-nitroimidazo[1,2-a]pyridin-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1nc2ccccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N3O6/c1-3-22-13(18)10(14(19)23-4-2)11-12(17(20)21)16-8-6-5-7-9(16)15-11/h5-8,10H,3-4H2,1-2H3 |
| InChIKey | QTJYNGCNUREVIG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|