C14H22N4O2S — CID 63197477
4-methyl-3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-propylpentan-2-amine (PubChem CID 63197477) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-methyl-3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-propylpentan-2-amine.
| Compound Name | 4-methyl-3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 63197477 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-methyl-3-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)-N-propylpentan-2-amine |
| SMILES | CCCNC(C)C(c1nc2sccn2c1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C14H22N4O2S/c1-5-6-15-10(4)11(9(2)3)12-13(18(19)20)17-7-8-21-14(17)16-12/h7-11,15H,5-6H2,1-4H3 |
| InChIKey | OHRUHDJQIWCSOO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|