C8H10N4O3S — CID 62348908
N-methyl-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyethanamine (PubChem CID 62348908) has the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. Its IUPAC name is N-methyl-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyethanamine.
| Compound Name | N-methyl-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyethanamine |
|---|---|
| PubChem CID | 62348908 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | N-methyl-2-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyethanamine |
| SMILES | CNCCOc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N4O3S/c1-9-2-4-15-6-7(12(13)14)11-3-5-16-8(11)10-6/h3,5,9H,2,4H2,1H3 |
| InChIKey | POLYYLDBPJMVNS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|