C10H5ClN4O3S — CID 86972120
6-[(2-chloro-3-pyridinyl)oxy]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 86972120) has the molecular formula C10H5ClN4O3S and a molecular weight of 296.70 g/mol. Its IUPAC name is 6-[(2-chloro-3-pyridinyl)oxy]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(2-chloro-3-pyridinyl)oxy]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 86972120 |
| Molecular Formula | C10H5ClN4O3S |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 6-[(2-chloro-3-pyridinyl)oxy]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(Oc2cccnc2Cl)nc2sccn12 |
| InChI | InChI=1S/C10H5ClN4O3S/c11-7-6(2-1-3-12-7)18-8-9(15(16)17)14-4-5-19-10(14)13-8/h1-5H |
| InChIKey | IQFPZQYSDXGZBD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|