C14H7N5O5S — CID 18230478
5-nitro-6-(5-nitroquinolin-8-yl)oxyimidazo[2,1-b][1,3]thiazole (PubChem CID 18230478) has the molecular formula C14H7N5O5S and a molecular weight of 357.31 g/mol. Its IUPAC name is 5-nitro-6-(5-nitroquinolin-8-yl)oxyimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-nitro-6-(5-nitroquinolin-8-yl)oxyimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 18230478 |
| Molecular Formula | C14H7N5O5S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 5-nitro-6-(5-nitroquinolin-8-yl)oxyimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2nc3sccn3c2[N+](=O)[O-])c2ncccc12 |
| InChI | InChI=1S/C14H7N5O5S/c20-18(21)9-3-4-10(11-8(9)2-1-5-15-11)24-12-13(19(22)23)17-6-7-25-14(17)16-12/h1-7H |
| InChIKey | WFTQIEZXAAUPPD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 125.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|