C12H10N4O3S — CID 106485625
[4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyphenyl]methanamine (PubChem CID 106485625) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is [4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyphenyl]methanamine.
| Compound Name | [4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyphenyl]methanamine |
|---|---|
| PubChem CID | 106485625 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [4-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxyphenyl]methanamine |
| SMILES | NCc1ccc(Oc2nc3sccn3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N4O3S/c13-7-8-1-3-9(4-2-8)19-10-11(16(17)18)15-5-6-20-12(15)14-10/h1-6H,7,13H2 |
| InChIKey | MPYDXGJNNLHXTK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|