C11H6N4O5S — CID 63851554
5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid (PubChem CID 63851554) has the molecular formula C11H6N4O5S and a molecular weight of 306.26 g/mol. Its IUPAC name is 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid.
| Compound Name | 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63851554 |
| Molecular Formula | C11H6N4O5S |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(Oc2nc3sccn3c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H6N4O5S/c16-10(17)6-3-7(5-12-4-6)20-8-9(15(18)19)14-1-2-21-11(14)13-8/h1-5H,(H,16,17) |
| InChIKey | MZPLQCAUGMPZML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|