About 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid
5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid (PubChem CID 63851554) has the molecular formula C11H6N4O5S
and a molecular weight of 306.26 g/mol. Its IUPAC name is 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid |
| PubChem CID | 63851554 |
| Molecular Formula | C11H6N4O5S |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(Oc2nc3sccn3c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H6N4O5S/c16-10(17)6-3-7(5-12-4-6)20-8-9(15(18)19)14-1-2-21-11(14)13-8/h1-5H,(H,16,17) |
| InChIKey | MZPLQCAUGMPZML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid?
The IUPAC name of 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid (CID 63851554) is 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid.
What is the SMILES notation for 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid?
The canonical SMILES for 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid is O=C(O)c1cncc(Oc2nc3sccn3c2[N+](=O)[O-])c1.
What is the InChIKey of 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid?
The InChIKey is MZPLQCAUGMPZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N4O5S/c16-10(17)6-3-7(5-12-4-6)20-8-9(15(18)19)14-1-2-21-11(14)13-8/h1-5H,(H,16,17).
What are the key properties of 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid?
5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid has a molecular weight of 306.26 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)oxypyridine-3-carboxylic acid is sourced from PubChem (CID 63851554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).