About 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole
6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 63205151) has the molecular formula C9H10BrN3O3S
and a molecular weight of 320.17 g/mol. Its IUPAC name is 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 63205151 |
| Molecular Formula | C9H10BrN3O3S |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | COCC(Br)Cc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10BrN3O3S/c1-16-5-6(10)4-7-8(13(14)15)12-2-3-17-9(12)11-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | NFBXYTJTHQXGBF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole (CID 63205151) is 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole is COCC(Br)Cc1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole?
The InChIKey is NFBXYTJTHQXGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3O3S/c1-16-5-6(10)4-7-8(13(14)15)12-2-3-17-9(12)11-7/h2-3,6H,4-5H2,1H3.
What are the key properties of 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole?
6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole has a molecular weight of 320.17 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-bromo-3-methoxypropyl)-5-nitroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 63205151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).