About 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid
3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid (PubChem CID 103153798) has the molecular formula C10H12N4O5S
and a molecular weight of 300.30 g/mol. Its IUPAC name is 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid.
Molecular Properties
| Compound Name | 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid |
| PubChem CID | 103153798 |
| Molecular Formula | C10H12N4O5S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid |
| SMILES | COC(CNc1nc2sccn2c1[N+](=O)[O-])CC(=O)O |
| InChI | InChI=1S/C10H12N4O5S/c1-19-6(4-7(15)16)5-11-8-9(14(17)18)13-2-3-20-10(13)12-8/h2-3,6,11H,4-5H2,1H3,(H,15,16) |
| InChIKey | GXQIPTLVBDSXEE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The IUPAC name of 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid (CID 103153798) is 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid.
What is the SMILES notation for 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The canonical SMILES for 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid is COC(CNc1nc2sccn2c1[N+](=O)[O-])CC(=O)O.
What is the InChIKey of 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The InChIKey is GXQIPTLVBDSXEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O5S/c1-19-6(4-7(15)16)5-11-8-9(14(17)18)13-2-3-20-10(13)12-8/h2-3,6,11H,4-5H2,1H3,(H,15,16).
What are the key properties of 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid has a molecular weight of 300.30 g/mol, XLogP of 1.21, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid is sourced from PubChem (CID 103153798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).