C13H10Cl2N4O3S — CID 133308109
1-(3,5-dichlorophenyl)-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]ethanol (PubChem CID 133308109) has the molecular formula C13H10Cl2N4O3S and a molecular weight of 373.22 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]ethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]ethanol |
|---|---|
| PubChem CID | 133308109 |
| Molecular Formula | C13H10Cl2N4O3S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]ethanol |
| SMILES | O=[N+]([O-])c1c(NCC(O)c2cc(Cl)cc(Cl)c2)nc2sccn12 |
| InChI | InChI=1S/C13H10Cl2N4O3S/c14-8-3-7(4-9(15)5-8)10(20)6-16-11-12(19(21)22)18-1-2-23-13(18)17-11/h1-5,10,16,20H,6H2 |
| InChIKey | JDLRINWDIZZXKE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|