C13H11BrN4O2S — CID 60677788
N-[1-(4-bromophenyl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 60677788) has the molecular formula C13H11BrN4O2S and a molecular weight of 367.23 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 60677788 |
| Molecular Formula | C13H11BrN4O2S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CC(Nc1nc2sccn2c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11BrN4O2S/c1-8(9-2-4-10(14)5-3-9)15-11-12(18(19)20)17-6-7-21-13(17)16-11/h2-8,15H,1H3 |
| InChIKey | QYNBAWXDLYGPHT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|