C7H9ClN2S — CID 91008654
6-chloroimidazo[2,1-b][1,3]thiazole;ethane (PubChem CID 91008654) has the molecular formula C7H9ClN2S and a molecular weight of 188.68 g/mol. Its IUPAC name is 6-chloroimidazo[2,1-b][1,3]thiazole;ethane.
| Compound Name | 6-chloroimidazo[2,1-b][1,3]thiazole;ethane |
|---|---|
| PubChem CID | 91008654 |
| Molecular Formula | C7H9ClN2S |
| Molecular Weight | 188.68 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 6-chloroimidazo[2,1-b][1,3]thiazole;ethane |
| SMILES | CC.Clc1cn2ccsc2n1 |
| InChI | InChI=1S/C5H3ClN2S.C2H6/c6-4-3-8-1-2-9-5(8)7-4;1-2/h1-3H;1-2H3 |
| InChIKey | HOLPMYXIJKQKMM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |