C7H8N2S2 — CID 23293465
6-ethylsulfanylimidazo[2,1-b][1,3]thiazole (PubChem CID 23293465) has the molecular formula C7H8N2S2 and a molecular weight of 184.29 g/mol. Its IUPAC name is 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 23293465 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 6-ethylsulfanylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCSc1cn2ccsc2n1 |
| InChI | InChI=1S/C7H8N2S2/c1-2-10-6-5-9-3-4-11-7(9)8-6/h3-5H,2H2,1H3 |
| InChIKey | YQMXQRYGJABYMS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |