C11H17N3S — CID 78925544
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)pentan-3-amine (PubChem CID 78925544) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)pentan-3-amine.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 78925544 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)pentan-3-amine |
| SMILES | CCC(CC)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H17N3S/c1-3-9(4-2)12-7-10-8-14-5-6-15-11(14)13-10/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | OPTLUFYMFURGFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |