C10H15N3OS — CID 115331507
2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)butan-1-ol (PubChem CID 115331507) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)butan-1-ol.
| Compound Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 115331507 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]thiazol-6-ylmethylamino)butan-1-ol |
| SMILES | CCC(CO)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-8(7-14)11-5-9-6-13-3-4-15-10(13)12-9/h3-4,6,8,11,14H,2,5,7H2,1H3 |
| InChIKey | RKDBXGGCYSAFTR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |