C10H15N3S — CID 81333805
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine (PubChem CID 81333805) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 81333805 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine |
| SMILES | CCC(C)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H15N3S/c1-3-8(2)11-6-9-7-13-4-5-14-10(13)12-9/h4-5,7-8,11H,3,6H2,1-2H3 |
| InChIKey | SXWGESFWJXFMGP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |