C10H14ClN3S — CID 83187591
4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine (PubChem CID 83187591) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine.
| Compound Name | 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 83187591 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-chloro-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)butan-2-amine |
| SMILES | CC(CCCl)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C10H14ClN3S/c1-8(2-3-11)12-6-9-7-14-4-5-15-10(14)13-9/h4-5,7-8,12H,2-3,6H2,1H3 |
| InChIKey | YQIRBJQVNYFRJR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|