C6H6Cl2N2S — CID 76851866
6-(chloromethyl)imidazo[2,1-b][1,3]thiazole;hydrochloride (PubChem CID 76851866) has the molecular formula C6H6Cl2N2S and a molecular weight of 209.10 g/mol. Its IUPAC name is 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole;hydrochloride.
| Compound Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole;hydrochloride |
|---|---|
| PubChem CID | 76851866 |
| Molecular Formula | C6H6Cl2N2S |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 6-(chloromethyl)imidazo[2,1-b][1,3]thiazole;hydrochloride |
| SMILES | Cl.ClCc1cn2ccsc2n1 |
| InChI | InChI=1S/C6H5ClN2S.ClH/c7-3-5-4-9-1-2-10-6(9)8-5;/h1-2,4H,3H2;1H |
| InChIKey | HZBWWRDELZYWOB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|