C16H13N3O2S — CID 68761163
2-(1-imidazo[2,1-b][1,3]thiazol-6-ylpropyl)isoindole-1,3-dione (PubChem CID 68761163) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-(1-imidazo[2,1-b][1,3]thiazol-6-ylpropyl)isoindole-1,3-dione.
| Compound Name | 2-(1-imidazo[2,1-b][1,3]thiazol-6-ylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 68761163 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(1-imidazo[2,1-b][1,3]thiazol-6-ylpropyl)isoindole-1,3-dione |
| SMILES | CCC(c1cn2ccsc2n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H13N3O2S/c1-2-13(12-9-18-7-8-22-16(18)17-12)19-14(20)10-5-3-4-6-11(10)15(19)21/h3-9,13H,2H2,1H3 |
| InChIKey | NWQBDHMSVSTEAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|