C15H13N3OS — CID 90625813
(E)-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)but-2-enamide (PubChem CID 90625813) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is (E)-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)but-2-enamide.
| Compound Name | (E)-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 90625813 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (E)-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccccc1-c1cn2ccsc2n1 |
| InChI | InChI=1S/C15H13N3OS/c1-2-5-14(19)16-12-7-4-3-6-11(12)13-10-18-8-9-20-15(18)17-13/h2-10H,1H3,(H,16,19)/b5-2+ |
| InChIKey | YQTFBTLJNVXJSL-GORDUTHDSA-N |
| XLogP | 3.58 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|