C18H12FN3OS — CID 90625740
2-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide (PubChem CID 90625740) has the molecular formula C18H12FN3OS and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide.
| Compound Name | 2-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
|---|---|
| PubChem CID | 90625740 |
| Molecular Formula | C18H12FN3OS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-fluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1-c1cn2ccsc2n1)c1ccccc1F |
| InChI | InChI=1S/C18H12FN3OS/c19-14-7-3-1-5-12(14)17(23)20-15-8-4-2-6-13(15)16-11-22-9-10-24-18(22)21-16/h1-11H,(H,20,23) |
| InChIKey | VLOAEHXNEMHYCK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |