C14H25NS — CID 86124626
2-octyl-4-propyl-1,3-thiazole (PubChem CID 86124626) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 2-octyl-4-propyl-1,3-thiazole.
| Compound Name | 2-octyl-4-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 86124626 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-octyl-4-propyl-1,3-thiazole |
| SMILES | CCCCCCCCc1nc(CCC)cs1 |
| InChI | InChI=1S/C14H25NS/c1-3-5-6-7-8-9-11-14-15-13(10-4-2)12-16-14/h12H,3-11H2,1-2H3 |
| InChIKey | CPGDWBVMCYVDOC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|