C8H14N2S — CID 59665191
N-methyl-4-(2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 59665191) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is N-methyl-4-(2-methylpropyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-(2-methylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 59665191 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N-methyl-4-(2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CNc1nc(CC(C)C)cs1 |
| InChI | InChI=1S/C8H14N2S/c1-6(2)4-7-5-11-8(9-3)10-7/h5-6H,4H2,1-3H3,(H,9,10) |
| InChIKey | JAPJFLDLBNHLQU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |