C6H11N3S — CID 61325594
4-(ethylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 61325594) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(ethylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 61325594 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-(ethylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCNCc1csc(N)n1 |
| InChI | InChI=1S/C6H11N3S/c1-2-8-3-5-4-10-6(7)9-5/h4,8H,2-3H2,1H3,(H2,7,9) |
| InChIKey | JQHSIPVIQPVZLP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |