C10H12N4S — CID 165457032
N-[(2-pyridazin-4-yl-1,3-thiazol-4-yl)methyl]ethanamine (PubChem CID 165457032) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is N-[(2-pyridazin-4-yl-1,3-thiazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-pyridazin-4-yl-1,3-thiazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 165457032 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(2-pyridazin-4-yl-1,3-thiazol-4-yl)methyl]ethanamine |
| SMILES | CCNCc1csc(-c2ccnnc2)n1 |
| InChI | InChI=1S/C10H12N4S/c1-2-11-6-9-7-15-10(14-9)8-3-4-12-13-5-8/h3-5,7,11H,2,6H2,1H3 |
| InChIKey | XPQDODOPLDPFGG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |