C10H14N4S2 — CID 65485633
4-[2-[(2-methyl-1,3-thiazol-4-yl)methylamino]ethyl]-1,3-thiazol-2-amine (PubChem CID 65485633) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 4-[2-[(2-methyl-1,3-thiazol-4-yl)methylamino]ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[(2-methyl-1,3-thiazol-4-yl)methylamino]ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65485633 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4-[2-[(2-methyl-1,3-thiazol-4-yl)methylamino]ethyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(CNCCc2csc(N)n2)cs1 |
| InChI | InChI=1S/C10H14N4S2/c1-7-13-9(6-15-7)4-12-3-2-8-5-16-10(11)14-8/h5-6,12H,2-4H2,1H3,(H2,11,14) |
| InChIKey | YTLAILWDRPZPSD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|