C11H20ClN5O — CID 154884970
2-(dimethylamino)-4-methyl-N-[2-(methylamino)ethyl]pyrimidine-5-carboxamide;hydrochloride (PubChem CID 154884970) has the molecular formula C11H20ClN5O and a molecular weight of 273.77 g/mol. Its IUPAC name is 2-(dimethylamino)-4-methyl-N-[2-(methylamino)ethyl]pyrimidine-5-carboxamide;hydrochloride.
| Compound Name | 2-(dimethylamino)-4-methyl-N-[2-(methylamino)ethyl]pyrimidine-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154884970 |
| Molecular Formula | C11H20ClN5O |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-(dimethylamino)-4-methyl-N-[2-(methylamino)ethyl]pyrimidine-5-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1cnc(N(C)C)nc1C.Cl |
| InChI | InChI=1S/C11H19N5O.ClH/c1-8-9(10(17)13-6-5-12-2)7-14-11(15-8)16(3)4;/h7,12H,5-6H2,1-4H3,(H,13,17);1H |
| InChIKey | LZKVUZXXPRMFFV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|