C17H16FN3O3 — CID 112829300
N-[2-(3-fluorophenoxy)ethyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 112829300) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112829300 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCOc3cccc(F)c3)n[nH]2)o1 |
| InChI | InChI=1S/C17H16FN3O3/c1-11-5-6-16(24-11)14-10-15(21-20-14)17(22)19-7-8-23-13-4-2-3-12(18)9-13/h2-6,9-10H,7-8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | WAYBAVPZMLEXTE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|