C14H20N2O3S — CID 120693059
(E)-2-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]hex-4-enoic acid (PubChem CID 120693059) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (E)-2-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693059 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (E)-2-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1csc(C(C)(C)C)n1)C(=O)O |
| InChI | InChI=1S/C14H20N2O3S/c1-5-6-7-9(12(18)19)15-11(17)10-8-20-13(16-10)14(2,3)4/h5-6,8-9H,7H2,1-4H3,(H,15,17)(H,18,19)/b6-5+ |
| InChIKey | OFFSRHVEZNSZSH-AATRIKPKSA-N |
| XLogP | 2.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|