C12H18N2O3S — CID 119171014
4-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]butanoic acid (PubChem CID 119171014) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119171014 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[(2-tert-butyl-1,3-thiazole-4-carbonyl)amino]butanoic acid |
| SMILES | CC(C)(C)c1nc(C(=O)NCCCC(=O)O)cs1 |
| InChI | InChI=1S/C12H18N2O3S/c1-12(2,3)11-14-8(7-18-11)10(17)13-6-4-5-9(15)16/h7H,4-6H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | WNVJSAJVSAURGY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|