C11H17N3O5S2 — CID 39182547
6-[[2-(methanesulfonamido)-1,3-thiazole-4-carbonyl]amino]hexanoic acid (PubChem CID 39182547) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-[[2-(methanesulfonamido)-1,3-thiazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(methanesulfonamido)-1,3-thiazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 39182547 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 6-[[2-(methanesulfonamido)-1,3-thiazole-4-carbonyl]amino]hexanoic acid |
| SMILES | CS(=O)(=O)Nc1nc(C(=O)NCCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C11H17N3O5S2/c1-21(18,19)14-11-13-8(7-20-11)10(17)12-6-4-2-3-5-9(15)16/h7H,2-6H2,1H3,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | NZCDUEIONPLUKU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|