C14H22N2O3S — CID 119235347
5-[[2-(2-tert-butyl-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid (PubChem CID 119235347) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-[[2-(2-tert-butyl-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(2-tert-butyl-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119235347 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[[2-(2-tert-butyl-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)(C)c1nc(CC(=O)NCCCCC(=O)O)cs1 |
| InChI | InChI=1S/C14H22N2O3S/c1-14(2,3)13-16-10(9-20-13)8-11(17)15-7-5-4-6-12(18)19/h9H,4-8H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | BHGDTMMKLSAAEU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|