C12H16N2O4S — CID 120513455
4-[[2-(oxolan-2-yl)-1,3-thiazole-4-carbonyl]amino]butanoic acid (PubChem CID 120513455) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-[[2-(oxolan-2-yl)-1,3-thiazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[2-(oxolan-2-yl)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120513455 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-[[2-(oxolan-2-yl)-1,3-thiazole-4-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1csc(C2CCCO2)n1 |
| InChI | InChI=1S/C12H16N2O4S/c15-10(16)4-1-5-13-11(17)8-7-19-12(14-8)9-3-2-6-18-9/h7,9H,1-6H2,(H,13,17)(H,15,16) |
| InChIKey | VIRGVCWVULUDNU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|