2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid

C14H20N2O4 — CID 67296662

IUPAC2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid
SMILESC=CCCCCCC(NC(=O)c1cc(C)on1)C(=O)O
InChIInChI=1S/C14H20N2O4/c1-3-4-5-6-7-8-11(14(18)19)15-13(17)12-9-10(2)20-16-12/h3,9,11H,1,4-8H2,2H3,(H,15,17)(H,18,19)
InChIKeyAZRSBCNICZLWTK-UHFFFAOYSA-N
MW280.32 g/mol
LogP2.30
Rot. Bonds9

About 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid

2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid (PubChem CID 67296662) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid.

Molecular Properties

Compound Name2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid
PubChem CID67296662
Molecular FormulaC14H20N2O4
Molecular Weight280.32 g/mol
Exact Mass280.14
IUPAC Name2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid
SMILESC=CCCCCCC(NC(=O)c1cc(C)on1)C(=O)O
InChIInChI=1S/C14H20N2O4/c1-3-4-5-6-7-8-11(14(18)19)15-13(17)12-9-10(2)20-16-12/h3,9,11H,1,4-8H2,2H3,(H,15,17)(H,18,19)
InChIKeyAZRSBCNICZLWTK-UHFFFAOYSA-N
XLogP2.30
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid?
The IUPAC name of 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid (CID 67296662) is 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid.
What is the SMILES notation for 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid?
The canonical SMILES for 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid is C=CCCCCCC(NC(=O)c1cc(C)on1)C(=O)O.
What is the InChIKey of 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid?
The InChIKey is AZRSBCNICZLWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-3-4-5-6-7-8-11(14(18)19)15-13(17)12-9-10(2)20-16-12/h3,9,11H,1,4-8H2,2H3,(H,15,17)(H,18,19).
What are the key properties of 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid?
2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid has a molecular weight of 280.32 g/mol, XLogP of 2.30, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]non-8-enoic acid is sourced from PubChem (CID 67296662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).