C11H14N2O5 — CID 120693945
(E)-2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]hex-4-enoic acid (PubChem CID 120693945) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is (E)-2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693945 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (E)-2-[(3-methoxy-1,2-oxazole-5-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(OC)no1)C(=O)O |
| InChI | InChI=1S/C11H14N2O5/c1-3-4-5-7(11(15)16)12-10(14)8-6-9(17-2)13-18-8/h3-4,6-7H,5H2,1-2H3,(H,12,14)(H,15,16)/b4-3+ |
| InChIKey | SSHGKWHPZMUDOM-ONEGZZNKSA-N |
| XLogP | 0.83 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|