C21H20O2S — CID 89492280
1-(1-benzothiophen-2-yl)-3-(4-tert-butylphenyl)propane-1,3-dione (PubChem CID 89492280) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-3-(4-tert-butylphenyl)propane-1,3-dione.
| Compound Name | 1-(1-benzothiophen-2-yl)-3-(4-tert-butylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 89492280 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-3-(4-tert-butylphenyl)propane-1,3-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CC(=O)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H20O2S/c1-21(2,3)16-10-8-14(9-11-16)17(22)13-18(23)20-12-15-6-4-5-7-19(15)24-20/h4-12H,13H2,1-3H3 |
| InChIKey | PQMHLUCGGYRKMX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|