C21H16O2S2 — CID 11850792
1,5-bis(1-benzothiophen-2-yl)pentane-1,5-dione (PubChem CID 11850792) has the molecular formula C21H16O2S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,5-bis(1-benzothiophen-2-yl)pentane-1,5-dione.
| Compound Name | 1,5-bis(1-benzothiophen-2-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 11850792 |
| Molecular Formula | C21H16O2S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1,5-bis(1-benzothiophen-2-yl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)c1cc2ccccc2s1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C21H16O2S2/c22-16(20-12-14-6-1-3-10-18(14)24-20)8-5-9-17(23)21-13-15-7-2-4-11-19(15)25-21/h1-4,6-7,10-13H,5,8-9H2 |
| InChIKey | OWOIXMIVOJTIBW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |