C13H14O3S2 — CID 114965164
1-(1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-one (PubChem CID 114965164) has the molecular formula C13H14O3S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-one.
| Compound Name | 1-(1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 114965164 |
| Molecular Formula | C13H14O3S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-4-methylsulfonylbutan-1-one |
| SMILES | CS(=O)(=O)CCCC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H14O3S2/c1-18(15,16)8-4-6-11(14)13-9-10-5-2-3-7-12(10)17-13/h2-3,5,7,9H,4,6,8H2,1H3 |
| InChIKey | CIDZXPLPZJFOPM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |