C46H54BNOS — CID 12014330
[2-(1-benzothiophen-2-yl)-2-oxoethyl]-tributylazanium;tetraphenylboranuide (PubChem CID 12014330) has the molecular formula C46H54BNOS and a molecular weight of 679.82 g/mol. Its IUPAC name is [2-(1-benzothiophen-2-yl)-2-oxoethyl]-tributylazanium;tetraphenylboranuide.
| Compound Name | [2-(1-benzothiophen-2-yl)-2-oxoethyl]-tributylazanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 12014330 |
| Molecular Formula | C46H54BNOS |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.40 |
| IUPAC Name | [2-(1-benzothiophen-2-yl)-2-oxoethyl]-tributylazanium;tetraphenylboranuide |
| SMILES | CCCC[N+](CCCC)(CCCC)CC(=O)c1cc2ccccc2s1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C22H34NOS/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-7-14-23(15-8-5-2,16-9-6-3)18-20(24)22-17-19-12-10-11-13-21(19)25-22/h1-20H;10-13,17H,4-9,14-16,18H2,1-3H3/q-1;+1 |
| InChIKey | JKMQJZIWGCMAFO-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|