C11H7Br2NOS — CID 115799108
1-(4,5-dibromothiophen-2-yl)-2-pyridin-3-ylethanone (PubChem CID 115799108) has the molecular formula C11H7Br2NOS and a molecular weight of 361.06 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-pyridin-3-ylethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 115799108 |
| Molecular Formula | C11H7Br2NOS |
| Molecular Weight | 361.06 g/mol |
| Exact Mass | 358.86 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H7Br2NOS/c12-8-5-10(16-11(8)13)9(15)4-7-2-1-3-14-6-7/h1-3,5-6H,4H2 |
| InChIKey | WSUAHDCZBAHVRC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |