C13H14Br2N2OS — CID 115778844
1-(4,5-dibromothiophen-2-yl)-2-(1,3-diethylpyrazol-5-yl)ethanone (PubChem CID 115778844) has the molecular formula C13H14Br2N2OS and a molecular weight of 406.14 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-(1,3-diethylpyrazol-5-yl)ethanone.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-(1,3-diethylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 115778844 |
| Molecular Formula | C13H14Br2N2OS |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-(1,3-diethylpyrazol-5-yl)ethanone |
| SMILES | CCc1cc(CC(=O)c2cc(Br)c(Br)s2)n(CC)n1 |
| InChI | InChI=1S/C13H14Br2N2OS/c1-3-8-5-9(17(4-2)16-8)6-11(18)12-7-10(14)13(15)19-12/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | OCKVLTJOLRPWAP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |