C20H16Cl2N3O2+ — CID 142957182
3-(3,4-dichlorophenyl)imino-1-[(3,5-dimethyl-1,2-oxazol-2-ium-4-yl)methyl]indol-2-one (PubChem CID 142957182) has the molecular formula C20H16Cl2N3O2+ and a molecular weight of 401.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)imino-1-[(3,5-dimethyl-1,2-oxazol-2-ium-4-yl)methyl]indol-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)imino-1-[(3,5-dimethyl-1,2-oxazol-2-ium-4-yl)methyl]indol-2-one |
|---|---|
| PubChem CID | 142957182 |
| Molecular Formula | C20H16Cl2N3O2+ |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)imino-1-[(3,5-dimethyl-1,2-oxazol-2-ium-4-yl)methyl]indol-2-one |
| SMILES | Cc1[nH+]oc(C)c1CN1C(=O)/C(=N/c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C20H15Cl2N3O2/c1-11-15(12(2)27-24-11)10-25-18-6-4-3-5-14(18)19(20(25)26)23-13-7-8-16(21)17(22)9-13/h3-9H,10H2,1-2H3/p+1/b23-19+ |
| InChIKey | PQABNDLOIWKIHV-FCDQGJHFSA-O |
| XLogP | 4.68 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|