C23H28N3O2+ — CID 4174637
1-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-3-(3,4-dimethylphenyl)iminoindol-2-one (PubChem CID 4174637) has the molecular formula C23H28N3O2+ and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-3-(3,4-dimethylphenyl)iminoindol-2-one.
| Compound Name | 1-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-3-(3,4-dimethylphenyl)iminoindol-2-one |
|---|---|
| PubChem CID | 4174637 |
| Molecular Formula | C23H28N3O2+ |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-[(2,6-dimethylmorpholin-4-ium-4-yl)methyl]-3-(3,4-dimethylphenyl)iminoindol-2-one |
| SMILES | Cc1ccc(/N=C2/C(=O)N(C[NH+]3CC(C)OC(C)C3)c3ccccc32)cc1C |
| InChI | InChI=1S/C23H27N3O2/c1-15-9-10-19(11-16(15)2)24-22-20-7-5-6-8-21(20)26(23(22)27)14-25-12-17(3)28-18(4)13-25/h5-11,17-18H,12-14H2,1-4H3/p+1/b24-22+ |
| InChIKey | XFGYCGMCYMQGTR-ZNTNEXAZSA-O |
| XLogP | 2.42 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|