C25H26N3O2+ — CID 7272314
1-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-naphthalen-2-yliminoindol-2-one (PubChem CID 7272314) has the molecular formula C25H26N3O2+ and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-naphthalen-2-yliminoindol-2-one.
| Compound Name | 1-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-naphthalen-2-yliminoindol-2-one |
|---|---|
| PubChem CID | 7272314 |
| Molecular Formula | C25H26N3O2+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[[(2S,6R)-2,6-dimethylmorpholin-4-ium-4-yl]methyl]-3-naphthalen-2-yliminoindol-2-one |
| SMILES | C[C@@H]1C[NH+](CN2C(=O)/C(=N\c3ccc4ccccc4c3)c3ccccc32)C[C@H](C)O1 |
| InChI | InChI=1S/C25H25N3O2/c1-17-14-27(15-18(2)30-17)16-28-23-10-6-5-9-22(23)24(25(28)29)26-21-12-11-19-7-3-4-8-20(19)13-21/h3-13,17-18H,14-16H2,1-2H3/p+1/b26-24-/t17-,18+ |
| InChIKey | HQIRBLVXPSNJDK-ZUEXFDECSA-O |
| XLogP | 2.96 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|