C22H26N3O+ — CID 7479750
3-(4-methylphenyl)imino-1-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-one (PubChem CID 7479750) has the molecular formula C22H26N3O+ and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)imino-1-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-one.
| Compound Name | 3-(4-methylphenyl)imino-1-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-one |
|---|---|
| PubChem CID | 7479750 |
| Molecular Formula | C22H26N3O+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 3-(4-methylphenyl)imino-1-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]indol-2-one |
| SMILES | Cc1ccc(/N=C2/C(=O)N(C[NH+]3CCC[C@@H](C)C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-16-9-11-18(12-10-16)23-21-19-7-3-4-8-20(19)25(22(21)26)15-24-13-5-6-17(2)14-24/h3-4,7-12,17H,5-6,13-15H2,1-2H3/p+1/b23-21+/t17-/m1/s1 |
| InChIKey | BEVHVSGZHFIYLQ-IJCFDHGGSA-O |
| XLogP | 2.73 |
| TPSA | 37.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|