C21H22IN3O — CID 92517755
3-(4-iodophenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one (PubChem CID 92517755) has the molecular formula C21H22IN3O and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-(4-iodophenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one.
| Compound Name | 3-(4-iodophenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one |
|---|---|
| PubChem CID | 92517755 |
| Molecular Formula | C21H22IN3O |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-(4-iodophenyl)imino-1-[[(3S)-3-methylpiperidin-1-yl]methyl]indol-2-one |
| SMILES | C[C@H]1CCCN(CN2C(=O)/C(=N/c3ccc(I)cc3)c3ccccc32)C1 |
| InChI | InChI=1S/C21H22IN3O/c1-15-5-4-12-24(13-15)14-25-19-7-3-2-6-18(19)20(21(25)26)23-17-10-8-16(22)9-11-17/h2-3,6-11,15H,4-5,12-14H2,1H3/b23-20+/t15-/m0/s1 |
| InChIKey | QATWVAXKVMWTDH-OZZWHHLJSA-N |
| XLogP | 4.45 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|