C22H22F3N3O2 — CID 17386938
1-[(2,6-dimethylmorpholin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 17386938) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-[(2,6-dimethylmorpholin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[(2,6-dimethylmorpholin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 17386938 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[(2,6-dimethylmorpholin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CC1CN(CN2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)CC(C)O1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-14-11-27(12-15(2)30-14)13-28-19-9-4-3-8-18(19)20(21(28)29)26-17-7-5-6-16(10-17)22(23,24)25/h3-10,14-15H,11-13H2,1-2H3/b26-20+ |
| InChIKey | MIMTXQAYZCKLNY-LHLOQNFPSA-N |
| XLogP | 4.24 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|