C26H18ClF3N2OS — CID 142862487
1-[3-(5-chloro-1-benzothiophen-2-yl)propyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 142862487) has the molecular formula C26H18ClF3N2OS and a molecular weight of 498.96 g/mol. Its IUPAC name is 1-[3-(5-chloro-1-benzothiophen-2-yl)propyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[3-(5-chloro-1-benzothiophen-2-yl)propyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 142862487 |
| Molecular Formula | C26H18ClF3N2OS |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1-[3-(5-chloro-1-benzothiophen-2-yl)propyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | O=C1/C(=N\c2cccc(C(F)(F)F)c2)c2ccccc2N1CCCc1cc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C26H18ClF3N2OS/c27-18-10-11-23-16(13-18)14-20(34-23)7-4-12-32-22-9-2-1-8-21(22)24(25(32)33)31-19-6-3-5-17(15-19)26(28,29)30/h1-3,5-6,8-11,13-15H,4,7,12H2/b31-24- |
| InChIKey | SVRDBCGVTVAKBS-QLTSDVKISA-N |
| XLogP | 7.67 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|