C31H32F3N3O2 — CID 58686009
1-[3-[3-(2-ethylpiperidin-1-yl)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 58686009) has the molecular formula C31H32F3N3O2 and a molecular weight of 535.61 g/mol. Its IUPAC name is 1-[3-[3-(2-ethylpiperidin-1-yl)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[3-[3-(2-ethylpiperidin-1-yl)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 58686009 |
| Molecular Formula | C31H32F3N3O2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 1-[3-[3-(2-ethylpiperidin-1-yl)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CCC1CCCCN1CCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C31H32F3N3O2/c1-2-24-12-5-6-17-36(24)18-9-19-39-26-14-8-13-25(21-26)37-28-16-4-3-15-27(28)29(30(37)38)35-23-11-7-10-22(20-23)31(32,33)34/h3-4,7-8,10-11,13-16,20-21,24H,2,5-6,9,12,17-19H2,1H3/b35-29+ |
| InChIKey | JDAVZSOMLYDXOW-OZMGXUMRSA-N |
| XLogP | 7.54 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|