C21H20F3N3O — CID 3463607
1-(piperidin-1-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 3463607) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is 1-(piperidin-1-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-(piperidin-1-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 3463607 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-(piperidin-1-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | O=C1/C(=N\c2cccc(C(F)(F)F)c2)c2ccccc2N1CN1CCCCC1 |
| InChI | InChI=1S/C21H20F3N3O/c22-21(23,24)15-7-6-8-16(13-15)25-19-17-9-2-3-10-18(17)27(20(19)28)14-26-11-4-1-5-12-26/h2-3,6-10,13H,1,4-5,11-12,14H2/b25-19- |
| InChIKey | FTMHXFWXUOVYBB-PLRJNAJWSA-N |
| XLogP | 4.62 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|